ethyl acetoacetate, sodium salt
ethyl acetoacetate, sodium salt
CAS: 15933-07-0
Molecular Formula: C6H10O3
ethyl acetoacetate, sodium salt - Names and Identifiers
| Name | ethyl acetoacetate, sodium salt |
| Synonyms | ethyl 2-oxobutanoate ethyl acetoacetate, sodium salt Ethyl 3-oxobutanoate sodium salt Butanoic acid, 2-oxo-, ethyl ester |
| CAS | 15933-07-0 |
| EINECS | 240-071-7 |
| InChI | InChI=1/C6H10O3.Na/c1-3-9-6(8)4-5(2)7;/h3-4H2,1-2H3;/q;+1 |
ethyl acetoacetate, sodium salt - Physico-chemical Properties
| Molecular Formula | C6H10O3 |
| Molar Mass | 130.14 |
| Density | 1.1066 (rough estimate) |
| Melting Point | 168℃ (dec.) |
| Boling Point | 162.05°C (estimate) |
| Appearance | Form Liquid, color Pale yellow |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.4730 (estimate) |
| MDL | MFCD03265336 |
| Use | Application 2-butanoic acid ethyl ester is an intermediate of organic synthesis and pharmaceutical intermediates, can be used in laboratory organic synthesis process and chemical medicine synthesis process. |
ethyl acetoacetate, sodium salt - Risk and Safety
| Hazard Class | IRRITANT |
ethyl acetoacetate, sodium salt - Upstream Downstream Industry
ethyl acetoacetate, sodium salt - Introduction
ethyl acetoacetate, sodium salt, chemical formula C6H9NaO3, is a colorless solid. The following is an introduction to the nature, use, formulation and safety information of ethyl acetoacetate, sodium salt:
Nature:
1. Appearance: ethyl acetoacetate, sodium salt is white crystalline powder.
2. Solubility: It is soluble in water and can form an alkaline solution.
3. Stability: ethyl acetoacetate, sodium salt is relatively stable at room temperature, but it will decompose under high temperature, humidity or light conditions.
Use:
1. Chemical Synthesis: ethyl acetoacetate, sodium salt is commonly used as acid catalyst in organic synthesis, which can promote the formation reaction of Ester.
2. Pharmaceutical field: It is also used in the synthesis of certain drugs, such as certain fungicides and drug intermediates.
Method:
ethyl acetoacetate, sodium salt can be obtained by reacting ethyl acetate with an alkaline substance (such as sodium hydroxide). The specific preparation method can be prepared by a simple transesterification reaction.
Safety Information:
1. ethyl acetoacetate, sodium salt is a corrosive substance, avoid contact with skin, eyes and respiratory tract.
2. Use with appropriate protective equipment, such as gloves, safety glasses and protective clothing.
3. Pay attention to avoid inhaling dust during use. If inhalation causes discomfort, it should be moved to a well-ventilated place immediately.
4. When storing, ethyl acetoacetate, sodium salt should be stored in a sealed container, away from high temperature, humidity and combustibles.
Nature:
1. Appearance: ethyl acetoacetate, sodium salt is white crystalline powder.
2. Solubility: It is soluble in water and can form an alkaline solution.
3. Stability: ethyl acetoacetate, sodium salt is relatively stable at room temperature, but it will decompose under high temperature, humidity or light conditions.
Use:
1. Chemical Synthesis: ethyl acetoacetate, sodium salt is commonly used as acid catalyst in organic synthesis, which can promote the formation reaction of Ester.
2. Pharmaceutical field: It is also used in the synthesis of certain drugs, such as certain fungicides and drug intermediates.
Method:
ethyl acetoacetate, sodium salt can be obtained by reacting ethyl acetate with an alkaline substance (such as sodium hydroxide). The specific preparation method can be prepared by a simple transesterification reaction.
Safety Information:
1. ethyl acetoacetate, sodium salt is a corrosive substance, avoid contact with skin, eyes and respiratory tract.
2. Use with appropriate protective equipment, such as gloves, safety glasses and protective clothing.
3. Pay attention to avoid inhaling dust during use. If inhalation causes discomfort, it should be moved to a well-ventilated place immediately.
4. When storing, ethyl acetoacetate, sodium salt should be stored in a sealed container, away from high temperature, humidity and combustibles.
Last Update：2024-04-09 02:00:42
Supplier List
Spot supply
Product Name: Ethyl 2-oxobutanoate Visit Supplier Webpage Request for quotationCAS: 15933-07-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: Ethyl 2-oxobutanoate Visit Supplier Webpage Request for quotationCAS: 15933-07-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History
Raw Materials for ethyl acetoacetate, sodium salt
1H-Pyrazole-1-acetic acid, 3,5-dimethyl-α-oxo-, ethyl ester
ETHYL 2-ETHYLACRYLATE 96
2-HYDROXY-N-BUTYRIC ACID ETHYL ESTER
Bromoethane
Diethyl oxalate
2-Oxobutyric acid
ETHYL 2-ETHYLACRYLATE 96
2-HYDROXY-N-BUTYRIC ACID ETHYL ESTER
Bromoethane
Diethyl oxalate
2-Oxobutyric acid
Downstream Products for ethyl acetoacetate, sodium salt